CAS 4612-28-6

1,3-Benzenediboronic acid

Description:

1,3-Benzenediboronic acid, with the CAS number 4612-28-6, is an organic compound characterized by the presence of two boronic acid functional groups attached to a benzene ring at the 1 and 3 positions. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. Its structure allows it to participate in various chemical reactions, particularly in the formation of boronate esters, which are useful in organic synthesis and materials science. 1,3-Benzenediboronic acid is often employed in cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds, making it valuable in the synthesis of complex organic molecules. Additionally, it can act as a ligand in coordination chemistry and has applications in the development of sensors and drug delivery systems due to its ability to form reversible complexes with diols. Its reactivity and versatility make it an important compound in both academic research and industrial applications.

Formula: C₆H₈B₂O₄

InChI: InChI=1/C6H8B2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,9-12H

SMILES: c1cc(cc(c1)B(O)O)B(O)O

Synonyms:

• 1,3-Phenylenediboronic acid
• Benzene-1,3-Diyldiboronic Acid

1,3-Benzenediboronic acid

CAS: 4612-28-6

Formula: C₆H₈B₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.7473

Ref: IN-DA0037SG

1,3-Benzenediboronic acid

CAS: 4612-28-6

Formula: C₆H₈B₂O₄

Molecular weight: 165.75

Ref: 7W-GK2438

1,3-Phenylenediboronic acid

CAS: 4612-28-6

1,3-Phenylenediboronic acid

Formula: C₆H₈B₂O₄

Purity: 98%

Color and Shape: white solid

Molecular weight: 165.75g/mol

Ref: 54-OR360033

1,3-Phenylenediboronic acid

CAS: 4612-28-6

Formula: C₆H₈B₂O₄

Purity: 97%

Color and Shape: White to off-white crystalline solid

Molecular weight: 165.75

Ref: 10-F045300