CAS 4613-62-1
:5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole (non-preferred name)
Description:
5-(2,2-Dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole, identified by CAS number 4613-62-1, is a complex organic compound characterized by its unique structural features, including multiple dioxole and dioxolane rings. This compound exhibits a high degree of molecular symmetry and contains several functional groups that contribute to its chemical reactivity and stability. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of dioxole rings suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. Additionally, the compound's structure may impart interesting properties such as solubility in various organic solvents and potential interactions with biological systems. However, specific data regarding its toxicity, environmental impact, and detailed physical properties would require further investigation and should be referenced from safety data sheets or chemical databases for comprehensive understanding.
Formula:C12H20O5
InChI:InChI=1/C12H20O5/c1-11(2)13-6-9(16-11)7-5-8-10(14-7)17-12(3,4)15-8/h7-10H,5-6H2,1-4H3
SMILES:CC1(C)OCC(C2CC3C(O2)OC(C)(C)O3)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Deoxy-1,2;5,6-di-O-isopropylidene-D-glucofuranose
CAS:3-Deoxy glucofuranose: used in drug glycosylation, custom synthesized, antiviral against Epstein-Barr virus.Formula:C12H20O5Color and Shape:SolidMolecular weight:244.28Ref: TM-TNU1050
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3-Deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose
CAS:Controlled ProductStability Hygroscopic
Applications An intermediate for 3-Deoxy-D-glucose.Formula:C12H20O5Color and Shape:NeatMolecular weight:244.293-Deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose
CAS:3-Deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose is an oligosaccharide that belongs to the group of polysaccharides. It is a methylated saccharide with a high degree of purity and can be custom synthesized for use as a carbohydrate in pharmaceuticals. 3-Deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose is used in the synthesis of glycosylations and has been shown to have antiviral activity against Epstein Barr virus by inhibiting viral protein synthesis.Formula:C12H20O5Purity:Min. 95%Molecular weight:244.29 g/mol


