CAS 4613-71-2
:5-O-Benzoyl-1,2-di-O-acetyl-3-deoxy-D-ribofuranose
Description:
5-O-Benzoyl-1,2-di-O-acetyl-3-deoxy-D-ribofuranose is a synthetic carbohydrate derivative that exhibits several notable characteristics. As a modified sugar, it features a ribofuranose backbone, which is a five-membered ring structure commonly found in nucleosides. The presence of benzoyl and acetyl groups indicates that this compound has been chemically modified to enhance its stability and solubility, making it useful in various biochemical applications. The acetyl groups can provide protection for hydroxyl functionalities, while the benzoyl group can contribute to the compound's lipophilicity. This compound is typically utilized in organic synthesis and may serve as an intermediate in the preparation of nucleoside analogs or other biologically active molecules. Its structural modifications can influence its reactivity and interactions with biological systems, making it a valuable compound in medicinal chemistry and pharmaceutical research. As with many chemical substances, proper handling and safety precautions are essential due to potential reactivity and toxicity.
Formula:C16H18O7
InChI:InChI=1/C16H18O7/c1-10(17)21-14-8-13(23-16(14)22-11(2)18)9-20-15(19)12-6-4-3-5-7-12/h3-7,13-14,16H,8-9H2,1-2H3/t13-,14+,16?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-O-Benzoyl-1',2'-O-diacetyl-3'-deoxy-D-ribofuranose
CAS:5-O-Benzoyl-1',2'-O-diacetyl-3'-deoxy-D-ribofuranose is a Carbohydrate Derivative.Formula:C16H18O7Color and Shape:SolidMolecular weight:322.31Ref: TM-TNU0748
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-D-ribofuranose
CAS:1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-D-ribofuranose is a carbohydrate that is used as a building block in the synthesis of oligosaccharides and polysaccharides. The compound is also used to modify glycoproteins to increase their stability and to improve their solubility. 1,2-O-Di-O-acetyl-5-O-benzoyl--3 -deoxy--D--ribofuranose has been modified with fluorination, saccharide methylation, glycosylation and polysaccharide synthesis.Formula:C16H18O7Purity:Min. 90%Color and Shape:PowderMolecular weight:322.31 g/molRef: 3D-MD04725
Discontinued product


