CAS 461432-27-9

1-C-[4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose

Description:

1-C-[4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose, with the CAS number 461432-27-9, is a chemical compound that features a glucopyranose sugar moiety linked to a substituted phenyl group. This compound is characterized by the presence of a chloro substituent and an ethoxyphenyl group, which contribute to its unique chemical properties and potential biological activities. The glucopyranose structure indicates that it is a carbohydrate, specifically a pyranose form of glucose, which is known for its role in various biochemical processes. The presence of the chloro and ethoxy groups suggests that this compound may exhibit interesting reactivity and could be of interest in medicinal chemistry or as a potential pharmaceutical agent. Its specific interactions, solubility, and stability would depend on the functional groups present and the overall molecular structure. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and biochemistry.

Formula: C₂₁H₂₅ClO₇

InChI: InChI=1S/C21H25ClO7/c1-2-28-15-6-3-12(4-7-15)9-13-10-14(5-8-16(13)22)21(27)20(26)19(25)18(24)17(11-23)29-21/h3-8,10,17-20,23-27H,2,9,11H2,1H3/t17-,18-,19+,20-,21?/m1/s1

InChI key: InChIKey=KYDGWGYAUCJZDV-AWGDKMGJSA-N

SMILES: OC1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2=CC(CC3=CC=C(OCC)C=C3)=C(Cl)C=C2

Synonyms:

• 1-C-[4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose
• D-Glucopyranose, 1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-

Dapagliflozin Impurity 10

CAS: 461432-27-9

Formula: C₂₁H₂₅ClO₇

Color and Shape: White To Off-White Solid

Molecular weight: 424.87

Ref: 4Z-D-6214

1-C-4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose

CAS: 461432-27-9

1-C-4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose is a natural product. It is an API impurity that has been synthesized by the custom synthesis process. 1-C-4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranose has been shown to have pharmacological activity in research and development studies and as a potential drug product.

Formula: C₂₁H₂₅ClO₇

Purity: Min. 95%

Molecular weight: 424.87 g/mol

Ref: 3D-IC181108

Dapagliflozin Impurity 79

CAS: 461432-27-9

Formula: C₂₁H₂₅ClO₇

Molecular weight: 424.9

Ref: ST-EA-CP-D8015