CAS 4615-85-4
:Phenol, 2,3,4,5,6-pentafluoro-, potassium salt (1:1)
Description:
Phenol, 2,3,4,5,6-pentafluoro-, potassium salt (1:1), with CAS number 4615-85-4, is a fluorinated aromatic compound characterized by the presence of five fluorine atoms attached to a phenolic structure, along with a potassium ion. This compound exhibits high thermal stability and is typically soluble in polar solvents due to the ionic nature of the potassium salt. The presence of multiple fluorine atoms enhances its hydrophobic properties and can influence its reactivity, making it less susceptible to oxidation compared to non-fluorinated phenols. Additionally, the fluorinated structure can impart unique biological and chemical properties, which may be of interest in various applications, including pharmaceuticals and agrochemicals. The potassium salt form indicates that it can dissociate in solution, releasing potassium ions, which may have implications for its behavior in biological systems or environmental contexts. Overall, this compound is notable for its unique combination of fluorination and ionic characteristics, which can affect its interactions and applications in chemical processes.
Formula:C6HF5O·K
InChI:InChI=1S/C6HF5O.K/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;
InChI key:InChIKey=KFVXQDFWRLMDRW-UHFFFAOYSA-N
SMILES:FC1=C(F)C(F)=C(O)C(F)=C1F.[K]
Synonyms:- Phenol, 2,3,4,5,6-pentafluoro-, potassium salt (1:1)
- Phenol, pentafluoro-, potassium salt
- Potassium, (pentafluorophenoxy)-
- Potassium pentafluorophenoxide
- Phenol, pentafluoro-, potassium deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.