CAS 4617-99-6
:(11E,13E)-6-{[4-(dimethylamino)-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-10-{[5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-4-yl propanoate (non-preferred name)
Description:
The chemical substance with the name "(11E,13E)-6-{[4-(dimethylamino)-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-10-{[5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-4-yl propanoate" and CAS number "4617-99-6" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as methoxy, dimethylamino, and hydroxy groups. This compound features a bicyclic framework and is likely to exhibit significant biological activity due to its structural components, which may interact with various biological targets. The presence of dimethylamino groups suggests potential for enhanced solubility and bioavailability, while the oxacyclohexadeca structure indicates a unique cyclic arrangement that could influence its chemical reactivity and stability. Additionally, the compound's stereochemistry, indicated by the (11E,13E) configuration, may play a crucial role in its pharmacological properties. Overall, this substance is of interest in medicinal chemistry and may have applications in drug development or therapeutic interventions.
Formula:C39H66N2O12
InChI:InChI=1/C39H66N2O12/c1-11-31(43)51-30-22-32(44)48-24(3)15-13-12-14-16-29(52-33-18-17-28(40(6)7)25(4)49-33)23(2)21-27(19-20-42)37(38(30)47-10)53-39-36(46)34(41(8)9)35(45)26(5)50-39/h12-14,16,20,23-30,33-39,45-46H,11,15,17-19,21-22H2,1-10H3/b13-12+,16-14+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Spiramycin EP Impurity H Ditrifluoroacetate
CAS:Formula:C39H66N2O12·2C2HF3O2Molecular weight:754.96 2*114.02Neospiramycin
CAS:<p>Neospiramycin is a major metabolite of Spiramycin I.</p>Formula:C39H66N2O12Color and Shape:SolidMolecular weight:754.95



