CAS 4619-18-5

4-(4-Chlorophenyl)butanoic acid

Description:

4-(4-Chlorophenyl)butanoic acid, with the CAS number 4619-18-5, is an organic compound characterized by its aromatic and aliphatic structure. It features a butanoic acid moiety attached to a para-chlorophenyl group, which contributes to its chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the chlorophenyl group. The presence of the carboxylic acid functional group (-COOH) allows it to exhibit acidic properties, making it capable of participating in various chemical reactions, such as esterification and amidation. Additionally, the chlorophenyl substituent can influence the compound's biological activity and reactivity, potentially making it useful in pharmaceutical applications. Its structural characteristics may also affect its melting point, boiling point, and reactivity with other chemical species. Overall, 4-(4-Chlorophenyl)butanoic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₀H₁₁ClO₂

InChI: InChI=1/C10H11ClO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)

SMILES: C(Cc1ccc(cc1)Cl)CC(=O)O

Synonyms:

• Benzenebutanoic acid, 4-chloro-

4-(4-Chlorophenyl)butanic acid

CAS: 4619-18-5

Formula: C₁₀H₁₁ClO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.6461

Ref: IN-DA00DBO3

4-(4-Chlorophenyl)butyric acid

CAS: 4619-18-5

4-(4-Chlorophenyl)butyric acid

Purity: 98%

Molecular weight: 198.649g/mol

Ref: 54-OR75160

4-(4-Chlorophenyl)butyric acid

CAS: 4619-18-5

Formula: C₁₀H₁₁ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.65

Ref: 10-F210357