CAS 462-34-0
:(T-4)-Trifluoro(tetrahydrofuran)boron
Description:
(T-4)-Trifluoro(tetrahydrofuran)boron, with the CAS number 462-34-0, is a chemical compound that features a boron atom coordinated with a tetrahydrofuran (THF) molecule and three fluorine atoms. This compound is characterized by its unique structure, where the presence of trifluoromethyl groups imparts significant reactivity and polarity. The tetrahydrofuran moiety contributes to its solubility in various organic solvents, making it useful in synthetic chemistry. The trifluoromethyl groups enhance the electrophilic character of the boron center, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with other ligands. Additionally, the compound is typically stable under standard conditions but may react with strong nucleophiles or bases. Its applications can be found in organic synthesis, particularly in the formation of organoboron compounds, which are valuable intermediates in pharmaceuticals and materials science. Safety precautions should be observed when handling this compound due to its potential reactivity and the toxicity of fluorinated compounds.
Formula:C4H8BF3O
InChI:InChI=1/C4H8O.B.3FH/c1-2-4-5-3-1;;;;/h1-4H2;;3*1H/q;+3;;;/p-3
InChI key:InChIKey=XYMZNNGTHKHCJH-UHFFFAOYSA-N
SMILES:[B+3]([F-])([F-])([F-])O1CCCC1
Synonyms:- (T-4)-Trifluoro(tetrahydrofuran)boron
- BF<sub>3</sub>·THF
- Borane, trifluoro-, compd. with tetrahydrofuran (1:1)
- Boron Trifluoride Tetra Hydra Furan Complex
- Boron Trifluoride Tetrahydrofurane
- Boron fluoride (BF<sub>3</sub>), compd. with tetrahydrofuran (1:1)
- Boron fluoride, compd. with tetrahydrofuran
- Boron trifluoride THF complex
- Boron trifluoride-THF complex (1:1)
- Boron trifluoride-tetrahydrofuran complex (1:1)
- Boron trifluoride-tetrahydrofuran compound
- Boron, trifluoro(tetrahydrofuran)-, (T-4)-
- Borontrifluoridetetrahydrofurancomplex
- Furan, tetrahydro-, compd. with BF<sub>3</sub>
- Furan, tetrahydro-, compd. with BF<sub>3</sub> (1:1)
- Furan, tetrahydro-, compd. with boron fluoride (BF<sub>3</sub>) (1:1)
- Furan, tetrahydro-, compd. with trifluoroborane (1:1)
- Tetrahydrofuran - Trifluoroborane (1:1)
- Trifluor(tetrahydrofuran)bor
- Trifluoro(Tetrahydrofuran)Boron
- Furan, tetrahydro-, compd. with BF3
- Boron trifluoride tetrahydrofuran complex
- Furan, tetrahydro-, compd. with BF3 (1:1)
- Furan, tetrahydro-, compd. with boron fluoride (BF3) (1:1)
- Boron trifluoride tetrahydrofuran complex 95%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Boron trifluoride-tetrahydrofuran complex, BF{3} 45.5%
CAS:<p>Boron trifluoride-tetrahydrofuran complex is used as a polymerization initiator and as a dopant in the semiconductor industry. It serves as a reagent for deoxofluorination of alcohols and carbonyls. Further, it is used in the synthesis of methacrylate-PEG-methacrylate-boron trifluoride self-doped ge</p>Formula:C4H8BF3OColor and Shape:Clear pale yellow to brown, LiquidMolecular weight:139.91Trifluoroborane tetrahydrofuran complex
CAS:Trifluoroborane tetrahydrofuran complexPurity:95%Molecular weight:139.91g/molBoron trifluoride tetrahydrofuran complex
CAS:Formula:C4H8BF3OColor and Shape:SolidMolecular weight:139.9119


