CAS 462-93-1

5-[(diaminomethylidene)amino]pentanoic acid

Description:

5-[(Diaminomethylidene)amino]pentanoic acid, commonly known as lysine, is an essential amino acid characterized by its aliphatic side chain containing two amino groups. It is a colorless, crystalline solid that is soluble in water, reflecting its polar nature due to the presence of multiple amino groups. This compound plays a crucial role in protein synthesis and is vital for various biological functions, including hormone production and immune response. Lysine is also involved in the synthesis of collagen and elastin, contributing to the structural integrity of tissues. Its basicity is attributed to the amino groups, which can accept protons, making it a key player in biochemical reactions. Additionally, lysine is often used in dietary supplements and is important in animal feed to promote growth and health. The compound's ability to form salts and its reactivity with acids and bases further enhance its utility in various chemical applications. Overall, lysine is a significant compound in both biological and industrial contexts.

Formula: C₆H₁₃N₃O₂

InChI: InChI=1/C6H13N3O2/c7-6(8)9-4-2-1-3-5(10)11/h1-4H2,(H,10,11)(H4,7,8,9)

SMILES: C(CCNC(=N)N)CC(=O)O

Synonyms:

• 5-Carbamimidamidopentanoic acid
• Pentanoic Acid, 5-[(Aminoiminomethyl)Amino]-

δ-Guanidinovaleric acid

CAS: 462-93-1

Formula: C₆H₁₃N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.1863

Ref: IN-DA00DSDT

5-Guanidinopentanoic acid

CAS: 462-93-1

Purity: 97%

Molecular weight: 159.1889954

Ref: 10-F773961

5-Guanidinopentanoic acid

Controlled Product

CAS: 462-93-1

Formula: C₆H₁₃N₃O₂

Color and Shape: Neat

Molecular weight: 159.186

Ref: TR-B440313