CymitQuimica logo

CAS 462066-84-8

:

6,8-Dimethylthieno[2,3-b]quinoline-2-carboxylic acid

Description:
6,8-Dimethylthieno[2,3-b]quinoline-2-carboxylic acid is a heterocyclic compound characterized by its fused thienoquinoline structure, which incorporates both sulfur and nitrogen atoms in its ring system. This compound features two methyl groups at the 6 and 8 positions, contributing to its unique chemical properties and potential biological activity. The carboxylic acid functional group at the 2-position enhances its solubility in polar solvents and allows for potential interactions in biological systems. The presence of the thieno and quinoline moieties suggests that this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure can influence its reactivity, stability, and interactions with other molecules, which are critical factors in drug design and development. Additionally, the compound's CAS number, 462066-84-8, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts.
Formula:C14H11NO2S
InChI:InChI=1S/C14H11NO2S/c1-7-3-8(2)12-9(4-7)5-10-6-11(14(16)17)18-13(10)15-12/h3-6H,1-2H3,(H,16,17)
InChI key:InChIKey=UYSGUMDGPPOZNK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(=NC=3C(C2)=CC(C)=CC3C)S1
Synonyms:
  • 6,8-Dimethylthieno[2,3-b]quinoline-2-carboxylic acid
  • Thieno[2,3-b]quinoline-2-carboxylic acid, 6,8-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.