CAS 462067-31-8

[3-(1H-tetrazol-1-yl)phenoxy]acetic acid

Description:

[3-(1H-tetrazol-1-yl)phenoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a phenoxy group and a tetrazole moiety. The presence of the tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their ability to mimic carboxylic acids and participate in various biochemical interactions. This compound is typically a white to off-white solid and is soluble in polar solvents, which may facilitate its use in various applications, including pharmaceuticals and agrochemicals. Its acidic nature is attributed to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its reactivity and solubility. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Additionally, its structural features allow for potential modifications that could enhance its efficacy or selectivity in biological systems. Overall, [3-(1H-tetrazol-1-yl)phenoxy]acetic acid represents a versatile scaffold for further research and development in chemical and pharmaceutical applications.

Formula: C₉H₈N₄O₃

InChI: InChI=1/C9H8N4O3/c14-9(15)5-16-8-3-1-2-7(4-8)13-6-10-11-12-13/h1-4,6H,5H2,(H,14,15)

SMILES: c1cc(cc(c1)OCC(=O)O)n1cnnn1

Synonyms:

• [3-(1H-tetraazol-1-yl)phenoxy]acetic acid
• Acetic acid, 2-[3-(1H-tetrazol-1-yl)phenoxy]-
• [3-(1H-Tetrazol-1-yl)phenoxy]acetic acid

[3-(1H-Tetrazol-1-yl)phenoxy]acetic acid

CAS: 462067-31-8

Formula: C₉H₈N₄O₃

Purity: 95.0%

Molecular weight: 220.188

Ref: 10-F042527