CymitQuimica logo

CAS 462067-90-9

:

4-amino-1,2-thiazole-3-carboxylic acid

Description:
4-Amino-1,2-thiazole-3-carboxylic acid is an organic compound characterized by its thiazole ring, which contains both nitrogen and sulfur atoms, contributing to its unique chemical properties. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) makes it a versatile molecule, capable of participating in various chemical reactions, including amide formation and decarboxylation. This compound is typically a white to off-white solid and is soluble in polar solvents due to its functional groups. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The thiazole structure is known for its role in various biochemical processes, and derivatives of this compound may exhibit significant pharmacological effects. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy in research applications.
Formula:C4H4N2O2S
InChI:InChI=1/C4H4N2O2S/c5-2-1-9-6-3(2)4(7)8/h1H,5H2,(H,7,8)
SMILES:c1c(c(C(=O)O)ns1)N
Synonyms:
  • 3-Isothiazolecarboxylic Acid, 4-Amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.