CAS 462068-47-9

Propanoic acid, 2-[(4-methyl-2-quinolinyl)thio]-

Description:

Propanoic acid, 2-[(4-methyl-2-quinolinyl)thio]- is a chemical compound characterized by its propanoic acid backbone, which features a carboxylic acid functional group (-COOH) that imparts acidic properties. The compound also contains a thioether linkage, indicated by the presence of a sulfur atom bonded to a quinoline derivative, specifically 4-methyl-2-quinoline. This structure contributes to its potential biological activity and may influence its solubility and reactivity. The presence of the quinoline moiety suggests possible applications in medicinal chemistry, as quinolines are known for their diverse pharmacological properties. The compound's molecular interactions may be affected by the steric and electronic effects of the methyl group on the quinoline ring. Additionally, the compound's CAS number, 462068-47-9, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic uses.

Formula: C₁₃H₁₃NO₂S

InChI: InChI=1S/C13H13NO2S/c1-8-7-12(17-9(2)13(15)16)14-11-6-4-3-5-10(8)11/h3-7,9H,1-2H3,(H,15,16)

InChI key: InChIKey=PZYFRXRGRLCMPV-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C(SC(C(O)=O)C)C1)C=CC=C2

Synonyms:

• Propanoic acid, 2-[(4-methyl-2-quinolinyl)thio]-
• 2-[(4-Methyl-2-quinolinyl)thio]propanoic acid
• 2-((4-Methylquinolin-2-yl)thio)propanoic acid

2-[(4-methyl-2-quinolinyl)thio]propanoic acid

CAS: 462068-47-9

Formula: C₁₃H₁₃NO₂S

Purity: 95.0%

Molecular weight: 247.31

Ref: 10-F315473