CAS 462068-54-8

3-[2-(propan-2-yl)-1H-imidazol-1-yl]propanoic acid

Description:

3-[2-(Propan-2-yl)-1H-imidazol-1-yl]propanoic acid, with the CAS number 462068-54-8, is a chemical compound characterized by its imidazole ring and a propanoic acid functional group. This compound features a branched alkyl group (isopropyl) attached to the imidazole, which contributes to its unique properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The imidazole moiety can participate in hydrogen bonding and may exhibit biological activity, making it of interest in pharmaceutical research. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its stability and reactivity can be influenced by the pH of the environment, and it may undergo various chemical reactions typical of carboxylic acids and nitrogen-containing heterocycles. Overall, this compound represents a versatile scaffold for further chemical modifications and investigations in various fields of chemistry and biochemistry.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1/C9H14N2O2/c1-7(2)9-10-4-6-11(9)5-3-8(12)13/h4,6-7H,3,5H2,1-2H3,(H,12,13)

SMILES: CC(C)c1nccn1CCC(=O)O

Synonyms:

• 1H-imidazole-1-propanoic acid, 2-(1-methylethyl)-
• 3-(2-isopropyl-1H-imidazol-1-yl)propanoic acid

3-(2-Isopropyl-imidazol-1-yl)-propionic acid

CAS: 462068-54-8

Formula: C₉H₁₄N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 182.223

Ref: 10-F028688