CAS 462068-57-1

[4-(1H-tetrazol-1-yl)phenyl]acetic acid

Description:

[4-(1H-tetrazol-1-yl)phenyl]acetic acid, with the CAS number 462068-57-1, is a chemical compound characterized by its unique structure that includes a phenyl ring substituted with a tetrazole group and an acetic acid moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for carboxylic acids, and it may display acidic behavior due to the presence of the carboxylic acid functional group. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their role in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting interactions with biological targets, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with specific pharmacological properties. Overall, [4-(1H-tetrazol-1-yl)phenyl]acetic acid represents a versatile chemical entity with implications in various fields of research and industry.

Formula: C₉H₈N₄O₂

InChI: InChI=1/C9H8N4O2/c14-9(15)5-7-1-3-8(4-2-7)13-6-10-11-12-13/h1-4,6H,5H2,(H,14,15)

SMILES: c1cc(ccc1CC(=O)O)n1cnnn1

Synonyms:

• [4-(1H-tetraazol-1-yl)phenyl]acetic acid
• Benzeneacetic acid, 4-(1H-tetrazol-1-yl)-
• [4-(1H-Tetrazol-1-yl)phenyl]acetic acid

(4-Tetrazol-1-yl-phenyl)-acetic acid

CAS: 462068-57-1

Formula: C₉H₈N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 204.1854

Ref: IN-DA00D9GT

2-(4-(1H-Tetrazol-1-yl)phenyl)acetic acid

CAS: 462068-57-1

2-(4-(1H-Tetrazol-1-yl)phenyl)acetic acid

Purity: 95%

Molecular weight: 204.19g/mol

Ref: 54-OR1052610

(4-Tetrazol-1-yl-phenyl)-acetic acid

CAS: 462068-57-1

Formula: C₉H₈N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.189

Ref: 10-F028142