CAS 462075-93-0

4-[(butylsulfanyl)methyl]-5-methylfuran-2-carboxylic acid

Description:

4-[(Butylsulfanyl)methyl]-5-methylfuran-2-carboxylic acid, with the CAS number 462075-93-0, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of a butylsulfanyl group indicates that it contains a butyl chain attached to a sulfur atom, which can influence its solubility and interaction with other molecules. The methyl group at the 5-position of the furan ring adds to its structural complexity and may affect its physical properties, such as boiling point and melting point. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure suggests potential applications in various fields, including medicinal chemistry and materials science. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as temperature and pH.

Formula: C₁₁H₁₆O₃S

InChI: InChI=1/C11H16O3S/c1-3-4-5-15-7-9-6-10(11(12)13)14-8(9)2/h6H,3-5,7H2,1-2H3,(H,12,13)

SMILES: CCCCSCc1cc(C(=O)O)oc1C

Synonyms:

• 2-Furancarboxylic Acid, 4-[(Butylthio)Methyl]-5-Methyl-

4-[(butylthio)methyl]-5-methyl-2-furoic acid

CAS: 462075-93-0

Formula: C₁₁H₁₆O₃S

Purity: 95.0%

Molecular weight: 228.31

Ref: 10-F314638