
CAS 4621-36-7
:3-Phenyldecane
Description:
3-Phenyldecane is an organic compound classified as an alkyl-substituted aromatic hydrocarbon. It features a decane backbone with a phenyl group attached to the third carbon atom. This compound is characterized by its hydrophobic nature, resulting from its long hydrocarbon chain, which contributes to its low solubility in water but higher solubility in organic solvents. 3-Phenyldecane typically exhibits a high boiling point and melting point relative to smaller hydrocarbons due to its larger molecular size and the presence of the phenyl group, which can influence intermolecular interactions. It is a colorless liquid at room temperature and is often used in organic synthesis and as a solvent in various chemical reactions. Additionally, its structure allows for potential applications in materials science and as a model compound in studies of hydrocarbon behavior. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H26
InChI:InChI=1S/C16H26/c1-3-5-6-7-9-12-15(4-2)16-13-10-8-11-14-16/h8,10-11,13-15H,3-7,9,12H2,1-2H3
InChI key:InChIKey=PYVIFMPVFLOTLN-UHFFFAOYSA-N
SMILES:C(CCCCCCC)(CC)C1=CC=CC=C1
Synonyms:- (1-Ethyloctyl)benzene
- Decane, 3-phenyl-
- 3-Phenyldecane
- (3-Decyl)benzene
- Benzene, (1-ethyloctyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

