CAS 462100-05-6

Cbz-NH-PEG2-CH2CH2COOH

Description:

Cbz-NH-PEG2-CH2CH2COOH, also known as a carbobenzyloxy (Cbz) protected amino acid derivative, is characterized by its unique structure that combines a carbobenzyloxy group with a polyethylene glycol (PEG) moiety and a carboxylic acid functional group. The presence of the PEG segment imparts solubility in aqueous environments, making it suitable for various biochemical applications, including drug delivery and bioconjugation. The Cbz group serves as a protective group for the amine, allowing for selective reactions without interfering with the amino functionality. The terminal carboxylic acid provides additional reactivity, enabling the formation of peptide bonds or conjugation with other biomolecules. This compound is typically used in peptide synthesis and as a building block in the development of biocompatible materials. Its properties, such as solubility, reactivity, and stability, make it a valuable tool in medicinal chemistry and materials science.

Formula: C₁₆H₂₃NO₇

InChI: InChI=1S/C16H23NO7/c18-15(19)13-23-11-10-22-9-8-21-7-6-17-16(20)24-12-14-4-2-1-3-5-14/h1-5H,6-13H2,(H,17,20)(H,18,19)

SMILES: c1ccc(cc1)COC(=NCCOCCOCCOCC(=O)O)O

Synonyms:

• 3-Oxo-1-phenyl-2,7,10,13-tetraoxa-4-azapentadecan-15-oic acid
• 2,7,10,13-Tetraoxa-4-azapentadecan-15-oic acid, 3-oxo-1-phenyl-

Z-9-aMino-4,7-dioxanonanoic acid

CAS: 462100-05-6

Formula: C₁₆H₂₃NO₇

Purity: 97%

Color and Shape: Liquid

Molecular weight: 341.3563

Ref: IN-DA00DHP7

Cbz-NH-PEG3-CH2COOH

CAS: 462100-05-6

Cbz-NH-PEG3-CH2COOH

Purity: ≥98%

Molecular weight: 341.36g/mol

Ref: 54-BUP15864

Cbz-NH-PEG3-CH2COOH

CAS: 462100-05-6

Cbz-NH-PEG3-CH2COOH is a PEG-based PROTAC linker that can be used in PROTAC synthesis.

Formula: C₁₆H₂₃NO₇

Purity: 98.01%

Color and Shape: Solid

Molecular weight: 341.36

Ref: TM-T17722

3-OXO-1-PHENYL-2,7,10,13-TETRAOXA-4-AZAPENTADECAN-15-OIC ACID

CAS: 462100-05-6

Purity: 98%

Molecular weight: 341.3599854

Ref: 10-F840952

Z-NH-PEG3-CH2COOH

CAS: 462100-05-6

Z-NH-PEG3-CH2COOH is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Z-NH-PEG3-CH2COOH is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₆H₂₃NO₇

Purity: Min. 95%

Molecular weight: 341.36 g/mol

Ref: 3D-FN73067