
CAS 4622-04-2
:3,6-Dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile
Description:
3,6-Dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile, with the CAS number 4622-04-2, is an organic compound characterized by its unique bicyclic structure featuring two carbonyl (C=O) groups and two cyano (C≡N) groups. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and materials science due to its reactive functional groups. The presence of both carbonyl and cyano functionalities suggests that it may participate in various chemical reactions, including nucleophilic additions and cycloadditions. Its molecular structure contributes to its stability and reactivity, making it of interest in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, the compound's properties, such as solubility and melting point, can vary depending on the solvent and conditions used. Safety data should be consulted for handling, as compounds with cyano groups can be toxic. Overall, 3,6-Dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile is a versatile compound with significant implications in chemical research and industry.
Formula:C8H2N2O2
InChI:InChI=1S/C8H2N2O2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2H
InChI key:InChIKey=DNXUGBMARDFRGG-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C#N)C(=O)C=CC1=O
Synonyms:- 2,3-Dicyano-p-benzoquinone
- 1,4-Cyclohexadiene-1,2-dicarbonitrile, 3,6-dioxo-
- 3,6-Dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile
- 2,3-Dicyano-p-quinone
- 2,3-Dicyanobenzoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-B-126007
Discontinued product
