CAS 46230-01-7

N-(furan-2-ylmethyl)pyridin-2-amine

Description:

N-(furan-2-ylmethyl)pyridin-2-amine, with the CAS number 46230-01-7, is an organic compound characterized by its unique structural features, which include a pyridine ring and a furan moiety. This compound typically exhibits properties associated with both heterocyclic aromatic systems, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amine group. The furan ring contributes to its reactivity, particularly in electrophilic substitution reactions, while the pyridine nitrogen can participate in coordination with metal ions, enhancing its potential applications in coordination chemistry and catalysis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Its stability and reactivity can be influenced by the substituents on the aromatic rings, which can affect its electronic properties. Overall, N-(furan-2-ylmethyl)pyridin-2-amine represents a versatile scaffold for further chemical modifications and applications in various fields of research.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-2-6-11-10(5-1)12-8-9-4-3-7-13-9/h1-7H,8H2,(H,11,12)

SMILES: c1ccnc(c1)NCc1ccco1

Synonyms:

• 2-pyridinamine, N-(2-furanylmethyl)-
• N-(2-Furylmethyl)pyridin-2-amine

N-(2-Furylmethyl)pyridin-2-amine hydrochloride

CAS: 46230-01-7

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 210.66 g/mol

Ref: 3D-WBA23001