CAS 46230-31-3

Phenylmethyl 2-(aminooxy)acetate

Description:

Phenylmethyl 2-(aminooxy)acetate, also known by its CAS number 46230-31-3, is an organic compound characterized by the presence of both an aminooxy group and an ester functional group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its structure features a phenylmethyl group, which contributes to its aromatic properties, and an aminooxy moiety that can participate in various chemical reactions, particularly in the formation of oxime derivatives. The aminooxy group is known for its ability to react with carbonyl compounds, making this substance potentially useful in synthetic organic chemistry, especially in the context of drug development and biochemical applications. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, Phenylmethyl 2-(aminooxy)acetate is a versatile compound with applications in both research and industry.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c10-13-7-9(11)12-6-8-4-2-1-3-5-8/h1-5H,6-7,10H2

InChI key: InChIKey=BTVNXMGKEXOFSW-UHFFFAOYSA-N

SMILES: C(OC(CON)=O)C1=CC=CC=C1

Synonyms:

• O-(Carbobenzyloxy)methylhydroxylamine
• Acetic acid, 2-(aminooxy)-, phenylmethyl ester
• Acetic acid, (aminooxy)-, phenylmethyl ester
• Phenylmethyl 2-(aminooxy)acetate

Benzyl 2-(aminooxy)acetate

CAS: 46230-31-3

Versatile small molecule scaffold

Formula: C₉H₁₁NO₃

Purity: Min. 95%

Molecular weight: 181.19 g/mol

Ref: 3D-WBA23031