CAS 46234-40-6

N-(4-chlorobenzyl)butan-2-amine

Description:

N-(4-chlorobenzyl)butan-2-amine, with the CAS number 46234-40-6, is an organic compound characterized by its amine functional group and a butyl chain. This compound features a 4-chlorobenzyl group attached to the nitrogen atom of the amine, which contributes to its chemical properties and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the chlorine atom enhances its lipophilicity, potentially affecting its interaction with biological systems. N-(4-chlorobenzyl)butan-2-amine may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis generally involves the alkylation of an amine with a suitable halide, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many amines, it may also exhibit basicity and can form salts with acids, which can influence its solubility and stability in different environments.

Formula: C₁₁H₁₆ClN

InChI: InChI=1/C11H16ClN/c1-3-9(2)13-8-10-4-6-11(12)7-5-10/h4-7,9,13H,3,8H2,1-2H3

SMILES: CCC(C)NCc1ccc(cc1)Cl

N-(4-chlorobenzyl)-2-butanamine hydrochloride

CAS: 46234-40-6

Formula: C₁₁H₁₇Cl₂N

Purity: 95.0%

Molecular weight: 234.16

Ref: 10-F359580