CAS 4624-70-8
:5-(1-methoxyethyl)-2-methyl-5-(propan-2-yl)-1,3-dioxane
Description:
5-(1-Methoxyethyl)-2-methyl-5-(propan-2-yl)-1,3-dioxane, with the CAS number 4624-70-8, is an organic compound characterized by its dioxane structure, which features a five-membered ring containing two oxygen atoms. This compound exhibits a complex molecular architecture due to the presence of various substituents, including a methoxyethyl group and isopropyl group, contributing to its unique chemical properties. It is likely to be a colorless to pale yellow liquid at room temperature, with moderate solubility in organic solvents and limited solubility in water due to its hydrophobic alkyl groups. The presence of the dioxane ring suggests potential applications in organic synthesis and as a solvent or intermediate in chemical reactions. Additionally, the compound may exhibit interesting physical properties such as boiling and melting points influenced by its molecular structure. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C11H22O3
InChI:InChI=1/C11H22O3/c1-8(2)11(9(3)12-5)6-13-10(4)14-7-11/h8-10H,6-7H2,1-5H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Dioxane, 5-isopropyl-5-(1-methoxyethyl)-2-methyl-, (E)-
CAS:m-Dioxane, 5-isopropyl-5-(1-methoxyethyl)-2-methyl-, (E)- is a bioactive chemical.Formula:C11H22O3Color and Shape:SolidMolecular weight:202.29
