CAS 46246-91-7

6-benzyl-2-oxa-6-azaspiro[3.3]heptane

Description:

6-Benzyl-2-oxa-6-azaspiro[3.3]heptane is a chemical compound characterized by its unique spirocyclic structure, which features a combination of both nitrogen and oxygen heteroatoms within its framework. The presence of a benzyl group contributes to its aromatic characteristics, potentially influencing its reactivity and interaction with biological systems. This compound is classified as a spirocyclic amine, which may exhibit interesting pharmacological properties due to its structural complexity. The oxazolidine and azaspiro components suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 46246-91-7, allows for easy identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. While specific physical and chemical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often display moderate to high lipophilicity, which can affect their bioavailability and interaction with biological targets. Further research is necessary to fully elucidate its potential uses and mechanisms of action.

Formula: C₁₂H₁₅NO

InChI: InChI=1/C12H15NO/c1-2-4-11(5-3-1)6-13-7-12(8-13)9-14-10-12/h1-5H,6-10H2

SMILES: c1ccc(cc1)CN1CC2(C1)COC2

Synonyms:

• 6-Benzyl-2-oxa-6-azaspiro[3.3]heptan

6-Benzyl-2-oxa-6-azaspiro[3.3]heptane

CAS: 46246-91-7

Formula: C₁₂H₁₅NO

Purity: 96%

Molecular weight: 189.2536

Ref: IN-DA00DB3B

6-Benzyl-2-oxa-6-azaspiro[3.3]heptane

CAS: 46246-91-7

Purity: 95%

Molecular weight: 189.25799560546875

Ref: 10-F787723

6-Benzyl-2-oxa-6-azaspiro[3.3]heptane

CAS: 46246-91-7

6-Benzyl-2-oxa-6-azaspiro[3.3]heptane

Purity: >98%

Molecular weight: 189.25g/mol

Ref: 54-OR510151