
CAS 4627-61-6
:N-[(9Z)-1-Oxo-9-octadecen-1-yl]-L-glutamic acid
Description:
N-[(9Z)-1-Oxo-9-octadecen-1-yl]-L-glutamic acid, with CAS number 4627-61-6, is a chemical compound that belongs to the class of amino acids and fatty acid derivatives. This substance features a long hydrocarbon chain, specifically an 18-carbon unsaturated fatty acid, which contributes to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of the glutamic acid moiety provides it with acidic properties, as glutamic acid is a well-known amino acid that plays a crucial role in protein synthesis and neurotransmission. The (9Z) configuration indicates the presence of a cis double bond in the fatty acid chain, which can influence the compound's biological activity and physical properties, such as melting point and solubility. This compound may have applications in biochemistry and pharmaceuticals, particularly in studies related to lipid metabolism and cellular signaling pathways. Its unique structure allows for potential interactions with various biological systems, making it a subject of interest in research.
Formula:C23H41NO5
InChI:InChI=1S/C23H41NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)24-20(23(28)29)18-19-22(26)27/h9-10,20H,2-8,11-19H2,1H3,(H,24,25)(H,26,27)(H,28,29)/b10-9-/t20-/m0/s1
InChI key:InChIKey=UUFVSGRELDGPGL-QJRAZLAKSA-N
SMILES:[C@H](NC(CCCCCCC/C=C\CCCCCCCC)=O)(CCC(O)=O)C(O)=O
Synonyms:- Glutamic acid, N-oleoyl-
- L-Glutamic acid, N-[(9Z)-1-oxo-9-octadecenyl]-
- L-Glutamic acid, N-(1-oxo-9-octadecenyl)-, (Z)-
- Glutamic acid, N-oleoyl-, L-
- L-Glutamic acid, N-[(9Z)-1-oxo-9-octadecen-1-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oleoyl glutamic acid
CAS:Oleoyl glutamic acid is a diacylglycerol analog.
Formula:C23H41NO5Color and Shape:SolidMolecular weight:411.58
