CAS 463-40-1: Linolenic acid
Description:Linolenic acid, with the CAS number 463-40-1, is a polyunsaturated fatty acid belonging to the omega-3 family. It is primarily found in plant oils, particularly flaxseed oil, chia seeds, and hemp oil. This fatty acid is characterized by its long carbon chain, containing 18 carbon atoms and three double bonds, which are positioned at the 9th, 12th, and 15th carbon atoms from the methyl end of the molecule. Linolenic acid is an essential fatty acid, meaning it cannot be synthesized by the human body and must be obtained through diet. It plays a crucial role in various physiological processes, including the regulation of inflammation and the maintenance of cell membrane integrity. Additionally, linolenic acid is known for its potential health benefits, such as supporting cardiovascular health and contributing to brain function. Its chemical structure allows it to participate in various biochemical pathways, making it an important component in nutrition and health.
Formula:C18H30O2
InChI:InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-
InChI key:InChIKey=DTOSIQBPPRVQHS-PDBXOOCHSA-N
SMILES:O=C(O)CCCCCCCC=CCC=CCC=CCC
- Synonyms:
- (9Z,12Z,15Z)-9,12,15-Octadecatrienoic acid
- (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
- (Z,Z,Z)-9,12,15-Octadecatrienoic acid
- (Z,Z,Z)-Octadeca-9,12,15-trienoic acid
- (all-Z)-9,12,15-Octadecatrienoic acid
- 18:3N-3
- 9,12,15-Octadecatrienoic acid, (9Z,12Z,15Z)-
- 9,12,15-Octadecatrienoic acid, (Z,Z,Z)-
- 9,12,15-all-cis-Octadecatrienoic acid
- 9-cis,12-cis,15-cis-Octadecatrienoic acid
- See more synonyms
- 9Z,12Z,15Z-Octadecatrienoic acid
- A-Linolenic Acid
- Acide linolenique
- Acido Linolenico, Bruto
- Brd-K33396764
- Linolenic acid
- Linolensaeure
- Linolensaure
- Octadeca-9,12,15-Trienoic Acid, (Z,Z,Z)-
- all cis-Delta-9,12,15-octadecatrienoate
- all-cis-9,12,15-Octadecatrienoic acid
- cis,cis,cis-9,12,15-Octadecatrienoic acid
- cis-9,cis-12,cis-15-Octadecatrienoic acid
- cis-Δ9,12,15-Octadecatrienoic acid
- cis-Δ<sup>9,12,15</sup>-Octadecatrienoic acid
