CAS 4630-07-3: Valencene
Description:Valencene is a naturally occurring sesquiterpene with the chemical formula C15H24, known for its distinct citrus aroma, reminiscent of grapefruit. It is primarily found in the peel of citrus fruits, particularly Valencia oranges, which is reflected in its name. Valencene is characterized by its colorless to pale yellow liquid form and has a relatively low boiling point, making it volatile. The compound is insoluble in water but soluble in organic solvents, which is typical for many terpenes. Valencene is often used in the fragrance and flavor industry due to its pleasant scent, and it also serves as a potential precursor for the synthesis of other valuable compounds. Additionally, it has garnered interest for its potential applications in agriculture as a natural insect repellent. Its structure features a bicyclic framework, contributing to its unique properties and reactivity. Overall, Valencene is a versatile compound with significant applications in various industries, particularly in enhancing sensory experiences in food and fragrance products.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1
InChI key:InChIKey=QEBNYNLSCGVZOH-NFAWXSAZSA-N
SMILES:C=C(C)C1CCC2=CCCC(C)C2(C)C1
- Synonyms:
- Valencene
- Naphthalene, 1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethenyl)-, (1R,7R,8aS)-
- Naphthalene, 1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethenyl)-, [1R-(1α,7β,8aα)]-
- (1R,7R,8aS)-1,2,3,5,6,7,8,8a-Octahydro-1,8a-dimethyl-7-(1-methylethenyl)naphthalene
- 4βH,5α-Eremophila-1(10),11-diene
