CAS 463336-07-4: 5-bromo-2-(4-fluorophenyl)pyridine

Description:5-Bromo-2-(4-fluorophenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a 4-fluorophenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic substituents, which can influence its solubility in organic solvents. It may also display interesting reactivity patterns, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The fluorine atom can enhance the compound's electronic properties, potentially affecting its reactivity and interactions with biological targets. Additionally, the presence of halogens like bromine and fluorine can impart specific pharmacological activities, making such compounds of interest in medicinal chemistry and drug development. Overall, 5-bromo-2-(4-fluorophenyl)pyridine is a versatile compound with applications in research and industry, particularly in the synthesis of more complex molecules.

Formula:C₁₁H₇BrFN

InChI:InChI=1/C11H7BrFN/c12-9-3-6-11(14-7-9)8-1-4-10(13)5-2-8/h1-7H

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-BROMO-2-(4-FLUOROPHENYL)PYRIDINE REF: IN-DA003MFYCAS: 463336-07-4	98%	To inquire	Tue 15 Apr 25
5-Bromo-2-(4-fluorophenyl)pyridine REF: 54-PC200356CAS: 463336-07-4	- - -	To inquire	Tue 22 Apr 25
5-Bromo-2-(4-fluorophenyl)pyridine REF: 10-F212058CAS: 463336-07-4	95.0%	To inquire	Wed 23 Apr 25
5-Bromo-2-(4-Fluorophenyl)Pyridine REF: 3D-FB81886CAS: 463336-07-4	Min. 95%	- - -	Discontinued product