
CAS 4638-03-3
:1-Chloro-3-(2-propen-1-yloxy)-2-propanol
Description:
1-Chloro-3-(2-propen-1-yloxy)-2-propanol, with the CAS number 4638-03-3, is an organic compound characterized by its functional groups, including a chloro group and an allyl ether. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar organic solvents. Its structure features a three-carbon backbone with a hydroxyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent makes it a suitable candidate for nucleophilic substitution reactions, while the allyl group can participate in various addition reactions, making it versatile in chemical transformations. Additionally, this compound may exhibit properties such as moderate volatility and a specific boiling point range, which are important for handling and storage. Due to its functional groups, it may also have applications in the production of polymers, pharmaceuticals, or as an intermediate in chemical synthesis. Safety data should be consulted for handling precautions, as it may pose health risks if not managed properly.
Formula:C6H11ClO2
InChI:InChI=1S/C6H11ClO2/c1-2-3-9-5-6(8)4-7/h2,6,8H,1,3-5H2
InChI key:InChIKey=DLVRPVNJFWEIFV-UHFFFAOYSA-N
SMILES:C(COCC=C)(CCl)O
Synonyms:- 2-Propanol, 1-(allyloxy)-3-chloro-
- 2-Propanol, 1-chloro-3-(2-propenyloxy)-
- 2-Propanol, 1-chloro-3-(2-propen-1-yloxy)-
- Allyl 3-chloro-2-hydroxypropyl ether
- 1-Chloro-3-(2-propen-1-yloxy)-2-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.