CAS 463961-43-5

3-(bromomethyl)cyclobutanone

Description:

3-(Bromomethyl)cyclobutanone is a cyclic ketone characterized by the presence of a bromomethyl group attached to a cyclobutanone ring. This compound features a four-membered carbon ring, which contributes to its unique strain and reactivity compared to larger cyclic structures. The bromomethyl group introduces a halogen, enhancing the compound's electrophilic character, making it potentially reactive in nucleophilic substitution reactions. The ketone functional group provides a site for further chemical transformations, such as reduction or condensation reactions. Its molecular structure allows for various applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of both a bromine atom and a carbonyl group can influence the compound's physical properties, such as solubility and boiling point. As with many halogenated compounds, safety precautions should be taken when handling 3-(bromomethyl)cyclobutanone due to potential toxicity and reactivity. Overall, this compound serves as an interesting building block in synthetic organic chemistry.

Formula: C₅H₇BrO

InChI: InChI=1/C5H7BrO/c6-3-4-1-5(7)2-4/h4H,1-3H2

SMILES: C1C(CC1=O)CBr

Synonyms:

• 3-(Bromomethyl)Cyclobutan-1-One
• Cyclobutanone, 3-(bromomethyl)-
• 3-(Bromomethyl)cyclobutanone

Cyclobutanone, 3-​(bromomethyl)​-

CAS: 463961-43-5

Formula: C₅H₇BrO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 163.0125

Ref: IN-DA00DPZP

3-(Bromomethyl)cyclobutanone

CAS: 463961-43-5

3-(Bromomethyl)cyclobutanone

Purity: ≥95%

Color and Shape: Light Yellow Liquid

Molecular weight: 163.01g/mol

Ref: 54-OR317135

3-(Bromomethyl)cyclobutanone

CAS: 463961-43-5

Formula: C₅H₇BrO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 163.014

Ref: 10-F329488