CAS 464-14-2
:1,1,2,2-Tetrafluoroethanesulfonic acid
Description:
1,1,2,2-Tetrafluoroethanesulfonic acid, with the CAS number 464-14-2, is a fluorinated sulfonic acid characterized by its strong acidity and unique chemical structure. It features a sulfonic acid group (-SO3H) attached to a tetrafluoroethane backbone, which contributes to its high thermal stability and resistance to hydrolysis. This compound is typically a colorless liquid or solid at room temperature and is highly soluble in polar solvents, making it useful in various applications, including as a catalyst or in the synthesis of fluorinated compounds. Its strong acidic nature allows it to protonate bases effectively, and it is often employed in the production of ion-exchange membranes and as a reagent in organic synthesis. Additionally, the presence of fluorine atoms enhances its chemical inertness and stability under harsh conditions. However, due to its potential environmental impact, particularly concerning fluorinated compounds, its use is subject to regulatory scrutiny. Overall, 1,1,2,2-Tetrafluoroethanesulfonic acid is a significant compound in both industrial and research settings.
Formula:C2H2F4O3S
InChI:InChI=1S/C2H2F4O3S/c3-1(4)2(5,6)10(7,8)9/h1H,(H,7,8,9)
InChI key:InChIKey=KZWJWYFPLXRYIL-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)(C(F)F)(F)F
Synonyms:- 1,1,2,2-Tetrafluoroethanesulfonic acid
- Ethanesulfonic acid, 1,1,2,2-tetrafluoro-
- 2-Hydrotetrafluoroethanesulfonic acid
- TFESA
- 1,1,2,2-Tetrafluoroethanesulfonic acid,TFESA
- TETRAFLUOROETHANESULFONIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,1,2,2-Tetrafluoroethanesulfonic acid
CAS:<p>1,1,2,2-Tetrafluoroethanesulfonic acid</p>Molecular weight:182.09409g/mol


