CAS 4640-01-1
:2,4-dichloro-1-(4-chloro-2-methoxyphenoxy)benzene
Description:
2,4-Dichloro-1-(4-chloro-2-methoxyphenoxy)benzene, with the CAS number 4640-01-1, is an organic compound characterized by its complex aromatic structure. It features two chlorine atoms and a methoxy group attached to a phenyl ring, contributing to its chemical stability and hydrophobic properties. This compound is typically a solid at room temperature and is known for its low solubility in water, which is common among chlorinated aromatic compounds. Its molecular structure suggests potential applications in agricultural chemistry, particularly as a herbicide or pesticide, due to its ability to interact with biological systems. Additionally, the presence of multiple halogen substituents can enhance its reactivity and influence its environmental persistence. Safety data indicates that it should be handled with care, as chlorinated compounds can pose risks to human health and the environment. Overall, 2,4-dichloro-1-(4-chloro-2-methoxyphenoxy)benzene exemplifies the characteristics of halogenated aromatic compounds, including stability, hydrophobicity, and potential biological activity.
Formula:C13H9Cl3O2
InChI:InChI=1/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3
SMILES:COc1cc(ccc1Oc1ccc(cc1Cl)Cl)Cl
Synonyms:- Benzene, 4-chloro-1-(2,4-dichlorophenoxy)-2-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Triclosan Methyl Ether
CAS:Formula:C13H9Cl3O2Purity:97%Color and Shape:SolidMolecular weight:303.56842,4-Dichloro-1-(4-chloro-2-methoxyphenoxy)benzene
CAS:2,4-Dichloro-1-(4-chloro-2-methoxyphenoxy)benzenePurity:97%Molecular weight:303.57g/molTriclosan-methyl
CAS:Triclosan-methyl, derived from bactericidal triclosan, is used in toothpaste, shampoos, soaps, detergents, and cosmetics.Formula:C13H9Cl3O2Color and Shape:SolidMolecular weight:303.57Triclosan-methyl ether 100 µg/mL in Acetonitrile
CAS:Formula:C13H9Cl3O2Color and Shape:Single SolutionMolecular weight:303.57Triclosan Methyl Ether
CAS:Controlled Product<p>Applications A bactericide detected in rivers and lakes. The current lot contains 8.7% d2, 0.2% d1 and 0.002% d0.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Lindstrom, A., et al.: Environ. Sci. Technol., 36, 2322 (2002)<br></p>Formula:C13H9Cl3O2Color and Shape:NeatMolecular weight:303.57Triclosan methyl ether
CAS:<p>Triclosan methyl ether (TME) is a versatile building block that can be used as a reagent, speciality chemical, and useful scaffold in synthesis. It has a high quality and is available at CAS No. 4640-01-1. TME is a reagent for the synthesis of organic compounds, such as triclosan, which has antimicrobial properties. TME is also used as an intermediate to prepare other chemicals with various applications, such as pharmaceuticals and pesticides.</p>Formula:C13H9Cl3O2Purity:Min. 95%Color and Shape:LiquidMolecular weight:303.57 g/mol2,4-Dichloro-1-(4-chloro-2-methoxyphenoxy)benzene
CAS:Formula:C13H9Cl3O2Purity:97%Molecular weight:303.56








