CAS 46415-29-6

1-(4-Ethoxyphenyl)piperazine

Description:

1-(4-Ethoxyphenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of the 4-ethoxyphenyl group indicates that an ethoxy group is attached to a phenyl ring at the para position relative to the piperazine moiety. This compound typically exhibits properties associated with both piperazine derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential biological activity. It may interact with various receptors in the central nervous system, making it of interest in pharmacological research. The compound's structure allows for potential modifications that can influence its pharmacokinetic and pharmacodynamic properties. Additionally, it may be synthesized through various organic reactions, including nucleophilic substitution or coupling reactions. As with many piperazine derivatives, it is essential to consider safety and handling precautions due to potential toxicity or reactivity. Overall, 1-(4-Ethoxyphenyl)piperazine serves as a valuable compound in medicinal chemistry and drug development.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c1-2-15-12-5-3-11(4-6-12)14-9-7-13-8-10-14/h3-6,13H,2,7-10H2,1H3

SMILES: CCOc1ccc(cc1)N1CCNCC1

Synonyms:

• Piperazine, 1-(4-ethoxyphenyl)-

1-(4-Ethoxyphenyl)piperazine

CAS: 46415-29-6

Formula: C₁₂H₁₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.2841

Ref: IN-DA00D7WU

1-(4-Ethoxyphenyl)piperazine

Controlled Product

CAS: 46415-29-6

Please enquire for more information about 1-(4-Ethoxyphenyl)piperazine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₈N₂O

Purity: Min. 95%

Molecular weight: 206.28 g/mol

Ref: 3D-FE147296