CAS 4649-12-1

2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanamine

Description:

2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanamine, with the CAS number 4649-12-1, is an organic compound characterized by its unique bicyclic structure, which includes a pyrrole and a pyridine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the ethylamine group contributes to its reactivity, making it a potential candidate for various chemical reactions, including alkylation and acylation. Additionally, the bicyclic structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be significant in biological systems, potentially affecting neurotransmitter pathways or other physiological processes. Overall, 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanamine is a compound of interest due to its structural features and potential applications in pharmacology and organic synthesis.

Formula: C₉H₁₁N₃

InChI: InChI=1/C9H11N3/c10-4-3-7-6-12-9-8(7)2-1-5-11-9/h1-2,5-6H,3-4,10H2,(H,11,12)

SMILES: c1cc2c(CCN)c[nH]c2nc1

Synonyms:

• 2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethanamin

[2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethyl]amine hydrochloride

CAS: 4649-12-1

Formula: C₉H₁₁N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.2037

Ref: IN-DA00DHXJ

2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethanamine

CAS: 4649-12-1

2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethanamine

Purity: 98%

Molecular weight: 161.21g/mol

Ref: 54-OR1061936

2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)ethanamine

CAS: 4649-12-1

Formula: C₉H₁₁N₃

Purity: 95.0%

Molecular weight: 161.208

Ref: 10-F228219