CAS 465-00-9: Arjunolic acid
Description:Arjunolic acid, with the CAS number 465-00-9, is a triterpenoid compound primarily derived from the bark of the Terminalia arjuna tree, which is traditionally used in Ayurvedic medicine. This compound is characterized by its pentacyclic structure, which contributes to its various biological activities. Arjunolic acid exhibits anti-inflammatory, antioxidant, and cardioprotective properties, making it of interest in pharmacological research. It has been studied for its potential benefits in cardiovascular health, including its ability to improve lipid profiles and support heart function. Additionally, arjunolic acid may possess antimicrobial and anticancer activities, although further research is needed to fully elucidate these effects. The compound is typically found in a solid form at room temperature and is soluble in organic solvents. Its therapeutic potential is being explored in various studies, highlighting its significance in natural product chemistry and medicinal applications.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=RWNHLTKFBKYDOJ-DDHMHSPCSA-N
SMILES:O=C(O)C12CCC(C)(C)CC2C3=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC4(C)C3(C)CC1
- Synonyms:
- (2Alpha,3Beta)-2,3,23-Trihydroxyolean-12-En-28-Oic Acid
- (2α,3β,4α)-2,3,23-Trihydroxyolean-12-en-28-oic acid
- 2,3,23-Trihydroxyolean-12-en-28-oic acid
- 2α,3β,23-Trihydroxyolean-12-en-28-oic acid
- Olean-12-en-28-oic acid, 2,3,23-trihydroxy-, (2α,3β,4α)-
- Olean-12-en-28-oic acid, 2α,3β,23-trihydroxy-
- Urjinolic acid
- Arjunolic acid
