CAS 465-00-9
:Arjunolic acid
Description:
Arjunolic acid, with the CAS number 465-00-9, is a triterpenoid compound primarily derived from the bark of the Terminalia arjuna tree, which is traditionally used in Ayurvedic medicine. This compound is characterized by its pentacyclic structure, which contributes to its various biological activities. Arjunolic acid exhibits anti-inflammatory, antioxidant, and cardioprotective properties, making it of interest in pharmacological research. It has been studied for its potential benefits in cardiovascular health, including its ability to improve lipid profiles and support heart function. Additionally, arjunolic acid may possess antimicrobial and anticancer activities, although further research is needed to fully elucidate these effects. The compound is typically found in a solid form at room temperature and is soluble in organic solvents. Its therapeutic potential is being explored in various studies, highlighting its significance in natural product chemistry and medicinal applications.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20+,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=RWNHLTKFBKYDOJ-DDHMHSPCSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@@H](O)[C@H](O)C5)[H])[H]
Synonyms:- (2Alpha,3Beta)-2,3,23-Trihydroxyolean-12-En-28-Oic Acid
- (2α,3β,4α)-2,3,23-Trihydroxyolean-12-en-28-oic acid
- 2,3,23-Trihydroxyolean-12-en-28-oic acid
- 2α,3β,23-Trihydroxyolean-12-en-28-oic acid
- Olean-12-en-28-oic acid, 2,3,23-trihydroxy-, (2α,3β,4α)-
- Olean-12-en-28-oic acid, 2α,3β,23-trihydroxy-
- Urjinolic acid
- Arjunolic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Arjunolic acid
CAS:Arjunolic acid shows promise for Alzheimer's treatment due to antioxidant, anti-inflammatory, and anti-nociceptive properties, and AChE/BuChE inhibition.Formula:C30H48O5Purity:99.74%Color and Shape:SolidMolecular weight:488.7Ref: TM-TN1403
1mg187.00€5mg416.00€10mg615.00€25mg938.00€50mg1,311.00€100mg1,768.00€1mL*10mM (DMSO)449.00€Arjunolic acid
CAS:Controlled ProductArjunolic acid is a hypoglycemic agent that belongs to the group of pharmacological agents. It is a reactive compound, which can be found in pueraria lobata and melaleuca alternifolia. Studies have shown that arjunolic acid has an effect on mitochondrial membrane potential, enzyme activities, and cardiac function. This compound also has anti-inflammatory activity and could be used for the treatment of inflammation. Arjunolic acid may have many other effects due to its ability to inhibit proinflammatory transcription factors such as NF-κB and AP-1.Formula:C30H48O5Purity:(Hplc-Ms) Min. 95 Area-%Color and Shape:PowderMolecular weight:488.7 g/mol






