CAS 465-02-1

Germanicol

Description:

Germanicol, with the CAS number 465-02-1, is a triterpenoid compound primarily derived from the plant genus *Germacra*. It is characterized by its complex molecular structure, which includes multiple fused rings typical of triterpenes. Germanicol is known for its potential biological activities, including anti-inflammatory and antimicrobial properties, making it of interest in pharmacological research. The compound is typically found in various natural sources, including certain essential oils and plant extracts. Its solubility is generally low in water but may dissolve in organic solvents, which is common for many terpenoids. Germanicol's structural features contribute to its reactivity and interaction with biological systems, and it may serve as a precursor for the synthesis of other bioactive compounds. Overall, Germanicol represents a significant area of study within natural product chemistry, particularly for its therapeutic potential and role in traditional medicine.

Formula: C₃₀H₅₀O

InChI: InChI=1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h19-20,22-24,31H,9-18H2,1-8H3/t20-,22+,23-,24+,27-,28+,29-,30-/m1/s1

InChI key: InChIKey=QMUXVPRGNJLGRT-PNTWTTAKSA-N

SMILES: C[C@]12[C@@]3(C)[C@@](C=4[C@@](C)(CC3)CCC(C)(C)C4)(CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](O)CC5)[H])[H])[H]

Synonyms:

• Olean-18-en-3-ol, (3β)-
• Germanicol
• Morol
• Olean-18-en-3β-ol
• (3β)-Olean-18-en-3-ol

GERMANICOL

CAS: 465-02-1

Formula: C₃₀H₅₀O

Purity: 97%

Color and Shape: Solid

Molecular weight: 426.7174

Ref: IN-DA00DW0G

Germanicol

CAS: 465-02-1

Germanicol hinders growth and migration of HCT-116/HT29 colon cancer cells by apoptosis and cell cycle arrest, and may reduce inflammation.

Formula: C₃₀H₅₀O

Purity: 98%

Color and Shape: Solid

Molecular weight: 426.72

Ref: TM-TN4132

Germanicol

CAS: 465-02-1

Germanicol is a pentacyclic triterpene, a naturally occurring organic compound found mainly in plants. It is biosynthesized through the cyclization of squalene, a precursor in the triterpenoid metabolic pathway, prevalent in various plant species. The primary mode of action of germanicol includes interacting with biological membranes and enzyme systems, potentially modulating inflammatory responses, oxidative stress, and cellular apoptosis. Its structure enables it to integrate into cellular processes, influencing various signaling pathways.

Formula: C₃₀H₅₀O

Purity: Min. 95%

Molecular weight: 426.70 g/mol

Ref: 3D-AAA46502