CAS 465514-19-6

{5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienyl}methanol

Description:

The chemical substance known as {5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienyl}methanol, with the CAS number 465514-19-6, exhibits several notable characteristics. It is a complex organic compound featuring a thienyl group and a pyrazole moiety, which contributes to its potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to be a solid at room temperature, given the structural complexity and the presence of multiple functional groups. Its solubility may vary depending on the solvent, but it is expected to be soluble in organic solvents due to its hydrophobic characteristics. The compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, this compound represents a unique structure that could have implications in drug development or material science.

Formula: C₁₀H₉F₃N₂OS

InChI: InChI=1/C10H9F3N2OS/c1-15-9(10(11,12)13)4-7(14-15)8-3-2-6(5-16)17-8/h2-4,16H,5H2,1H3

SMILES: Cn1c(cc(c2ccc(CO)s2)n1)C(F)(F)F

Synonyms:

• 5-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienylmethanol
• {5-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophen-2-yl}methanol

{5-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienyl}methanol

CAS: 465514-19-6

{5-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-thienyl}methanol

Purity: ≥95%

Molecular weight: 262.25g/mol

Ref: 54-PC31884