CAS 465514-27-6

4-(1H-pyrrol-1-yl)benzylamine

Description:

4-(1H-pyrrol-1-yl)benzylamine is an organic compound characterized by its structure, which features a benzylamine moiety attached to a pyrrole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential basicity due to the amine group and the presence of a nitrogen atom in the pyrrole ring. It may display moderate solubility in polar solvents, influenced by the functional groups present. The compound is of interest in medicinal chemistry and drug development, as derivatives of benzylamines and pyrroles often exhibit biological activity. Its molecular interactions can be influenced by hydrogen bonding and π-π stacking due to the aromatic nature of the benzyl group and the pyrrole ring. Additionally, the compound's reactivity may allow for further functionalization, making it a versatile building block in synthetic organic chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₁H₁₂N₂

InChI: InChI=1/C11H12N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H,9,12H2

SMILES: c1ccn(c1)c1ccc(cc1)CN

Synonyms:

• 1-[4-(1H-pyrrol-1-yl)phenyl]methanamine

4-(1H-Pyrrol-1-yl)benzenemethanamine

CAS: 465514-27-6

Formula: C₁₁H₁₂N₂

Molecular weight: 172.2264

Ref: IN-DA00D8I8

[4-(1H-Pyrrol-1-yl)phenyl]methylamine

CAS: 465514-27-6

[4-(1H-Pyrrol-1-yl)phenyl]methylamine

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.23g/mol

Ref: 54-OR23401