CAS 465514-63-0

N~1~-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]propane-1,3-diamine

Description:

N~1~-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]propane-1,3-diamine, with CAS number 465514-63-0, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group. This compound features a propane backbone with two amine functional groups, which contribute to its potential reactivity and solubility in various solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The chlorine atom can also participate in various chemical reactions, such as nucleophilic substitutions. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and should be evaluated in experimental settings for practical applications.

Formula: C₉H₁₁ClF₃N₃

InChI: InChI=1/C9H11ClF3N3/c10-7-4-6(9(11,12)13)5-16-8(7)15-3-1-2-14/h4-5H,1-3,14H2,(H,15,16)

SMILES: C(CN)CNc1c(cc(cn1)C(F)(F)F)Cl

Synonyms:

• N-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]propane-1,3-diamine

N1-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]propane-1,3-diamine

CAS: 465514-63-0

Formula: C₉H₁₁ClF₃N₃

Purity: 95.0%

Molecular weight: 253.65

Ref: 10-F522389