CAS 465531-97-9
:2,4,6-Triamino-5-pyrimidinecarbonitrile
Description:
2,4,6-Triamino-5-pyrimidinecarbonitrile is a chemical compound characterized by its pyrimidine ring structure, which is substituted with three amino groups at the 2, 4, and 6 positions, and a cyano group at the 5 position. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The presence of the cyano group contributes to its potential reactivity and may influence its electronic properties. 2,4,6-Triamino-5-pyrimidinecarbonitrile is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its biological activity, particularly in relation to its interactions with biological targets. Safety data should be consulted when handling this compound, as with any chemical substance.
Formula:C5H6N6
InChI:InChI=1/C5H6N6/c6-1-2-3(7)10-5(9)11-4(2)8/h(H6,7,8,9,10,11)
SMILES:C(#N)c1c(N)[nH]c(=N)[nH]c1=N
Synonyms:- 2,4,6-Triaminopyrimidin-5-carbonitril
- 2,4,6-Triaminopyrimidine-5-carbonitrile
- 5-Pyrimidinecarbonitrile, 2,4,6-Triamino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Pyrimidinecarbonitrile, 2,4,6-triamino-
CAS:Formula:C5H6N6Purity:95%Color and Shape:SolidMolecular weight:150.14132,4,6-Triaminopyrimidine-5-carbonitrile
CAS:2,4,6-Triaminopyrimidine-5-carbonitrilePurity:95%Molecular weight:150.14g/mol2,4,6-Triamino-5-pyrimidinecarbonitrile
CAS:Applications 2,4,6-Triamino-5-pyrimidinecarbonitrile is a photodegradation product of two isostructural pesticides in aqueous solution: Cyromazine (C989300) and Dicyclanil.
References Kimbrough, R., et al.: Environ. Sci. Technol., 30, 908 (1996), Root, D., et al.: Pesticide Sci., 48, 25 (1996), Yokley, R., et al.: J. Agric. Food Chem., 48, 3352 (2000),Formula:C5H6N6Color and Shape:NeatMolecular weight:150.14





