CAS 465536-44-1

(4S,4aS,8aS)-4-phenyldecahydroquinolin-4-ol

Description:

(4S,4aS,8aS)-4-phenyldecahydroquinolin-4-ol is a chemical compound characterized by its complex bicyclic structure, which includes a quinoline framework. This compound features a phenyl group attached to the saturated ring system, contributing to its unique properties. The presence of multiple stereocenters indicates that it can exist in different stereoisomeric forms, which may influence its biological activity and interactions. The hydroxyl (-OH) group at the 4-position of the quinoline ring enhances its potential for hydrogen bonding, affecting solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or cardiovascular systems. Additionally, the stereochemistry plays a crucial role in determining its efficacy and safety profile in biological systems. Overall, (4S,4aS,8aS)-4-phenyldecahydroquinolin-4-ol represents a fascinating subject for further research in organic and medicinal chemistry.

Formula: C₁₅H₂₁NO

InChI: InChI=1/C15H21NO/c17-15(12-6-2-1-3-7-12)10-11-16-14-9-5-4-8-13(14)15/h1-3,6-7,13-14,16-17H,4-5,8-11H2/t13-,14-,15+/m0/s1

rac-(4S,4aS,8aS)-4-phenyldecahydro-4-quinolinol

CAS: 465536-44-1

Formula: C₁₅H₂₁NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 231.339

Ref: 10-F313519