CAS 465546-82-1
:5-(benzyloxy)-1,3-dihydro-2H-benzimidazole-2-thione
Description:
5-(Benzyloxy)-1,3-dihydro-2H-benzimidazole-2-thione is a chemical compound characterized by its unique structural features, which include a benzimidazole core and a thione functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its applications in pharmaceuticals. The benzyloxy group enhances its solubility and may influence its reactivity and interaction with biological targets. The thione group contributes to the compound's potential as a ligand in coordination chemistry and may also play a role in its antioxidant properties. In terms of physical characteristics, compounds of this nature often have moderate to high melting points and can be soluble in organic solvents. The compound's reactivity can be influenced by the presence of functional groups, making it a candidate for further chemical modifications or applications in drug development. Overall, 5-(benzyloxy)-1,3-dihydro-2H-benzimidazole-2-thione represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C14H12N2OS
InChI:InChI=1/C14H12N2OS/c18-14-15-12-7-6-11(8-13(12)16-14)17-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,15,16,18)
SMILES:c1ccc(cc1)COc1ccc2c(c1)[nH]c(n2)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Benzyloxy-2-mercaptobenzimidazole
CAS:Controlled ProductFormula:C14H12N2OSColor and Shape:NeatMolecular weight:256.32
