CAS 4657-58-3

Cycloartanol

Description:

Cycloartanol is a triterpenoid compound characterized by its unique cycloartane structure, which consists of a tetracyclic framework. It is primarily derived from various plant sources, particularly those in the family Asteraceae. Cycloartanol exhibits a range of biological activities, including potential anti-inflammatory and antioxidant properties, making it of interest in pharmacological research. The compound is typically found in the form of a white to pale yellow crystalline solid and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Its molecular formula reflects a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its diverse chemical behavior. Cycloartanol is often studied for its role in plant metabolism and its potential applications in natural product synthesis and medicinal chemistry. Additionally, it serves as a precursor for the synthesis of other bioactive compounds, highlighting its significance in both natural and synthetic chemistry contexts.

Formula: C₃₀H₅₂O

InChI: InChI=1S/C30H52O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h20-25,31H,8-19H2,1-7H3/t21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1

InChI key: InChIKey=YABASAWVVRQMEU-YBXTVTTCSA-N

SMILES: C[C@]12[C@]3([C@]4([C@]5(C4)[C@](C(C)(C)[C@@H](O)CC5)(CC3)[H])CC[C@]1(C)[C@@]([C@@H](CCCC(C)C)C)(CC2)[H])[H]

Synonyms:

• 9,19-Cyclo-9β-lanostan-3β-ol
• Cycloartanol
• (3β)-9,19-Cyclolanostan-3-ol
• 9,19-Cyclolanostan-3β-ol
• 9,19-Cyclolanostan-3-ol, (3β)-

Cycloartanol

CAS: 4657-58-3

Formula: C₃₀H₅₂O

Purity: 98.0%

Molecular weight: 428.7333

Ref: IN-DA003A6Y

Cycloartanol

CAS: 4657-58-3

Cycloartanol is a natural product from Citrus medica.

Formula: C₃₀H₅₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 428.745

Ref: TM-TN3738

Cycloartanol

CAS: 4657-58-3

Formula: C₃₀H₅₂O

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 428.745

Ref: BP-SBP02695

Cycloartanol

CAS: 4657-58-3

Cycloartanol is a triterpenoid alcohol, which is primarily derived from plant sources, particularly from the cell membranes of various plant species. As a phytosterol, it plays a critical role in the stabilization of cell membranes and serves as a precursor in the biosynthesis of more complex steroidal compounds. The mode of action of cycloartanol involves its integration into lipid bilayers, contributing to membrane fluidity and integrity, and potentially interacting with various biochemical pathways within the plant systems.

Formula: C₃₀H₅₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 428.7 g/mol

Ref: 3D-EAA65758