CAS 4663-98-3
:3,4-pyridinedicarboxamide
Description:
3,4-Pyridinedicarboxamide, with the CAS number 4663-98-3, is an organic compound characterized by its pyridine ring structure substituted with two carboxamide groups at the 3 and 4 positions. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amide functional groups that can engage in hydrogen bonding. The presence of the pyridine ring imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 3,4-Pyridinedicarboxamide may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point and boiling point can vary based on purity and environmental conditions. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H7N3O2
InChI:InChI=1/C7H7N3O2/c8-6(11)4-1-2-10-3-5(4)7(9)12/h1-3H,(H2,8,11)(H2,9,12)
SMILES:c1cncc(c1C(=O)N)C(=N)O
Synonyms:- Pyridine-3,4-Dicarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
