CAS 4664-55-5

2-phenoxyacetohydrazide

Description:

2-Phenoxyacetohydrazide is an organic compound characterized by its hydrazide functional group attached to a phenoxyacetyl moiety. It typically appears as a white to off-white crystalline solid. The compound is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but its solubility in water is limited. 2-Phenoxyacetohydrazide is known for its potential applications in medicinal chemistry, particularly as a precursor in the synthesis of various pharmaceuticals and agrochemicals. It may exhibit biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in drug development. The compound's structure allows for various chemical modifications, which can enhance its efficacy or alter its properties. As with many hydrazides, it may also participate in condensation reactions, forming more complex molecules. Safety data should be consulted for handling and usage, as hydrazine derivatives can be hazardous. Overall, 2-phenoxyacetohydrazide represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c9-10-8(11)6-12-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11)

SMILES: c1ccc(cc1)OCC(=NN)O

Synonyms:

• Acetic Acid, 2-Phenoxy-, Hydrazide
• Acetic acid, phenoxy-, hydrazide

2-Phenoxyacetohydrazide

CAS: 4664-55-5

Formula: C₈H₁₀N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA00D8UR

2-Phenoxyacetohydrazide

CAS: 4664-55-5

2-Phenoxyacetohydrazide

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.18g/mol

Ref: 54-OR912008

Phenoxy-acetic acid hydrazide

CAS: 4664-55-5

Formula: C₈H₁₀N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 166.18

Ref: 10-F060616