CAS 4668-42-2: Z-L-aspartic acid 1-methyl ester
Description:Z-L-aspartic acid 1-methyl ester, also known by its CAS number 4668-42-2, is a derivative of aspartic acid, an amino acid that plays a crucial role in various biological processes. This compound features a Z (or benzyloxycarbonyl) protecting group on the amino group, which enhances its stability and solubility in organic solvents. It is typically a white to off-white crystalline solid, and its molecular structure includes both carboxylic acid and ester functional groups, contributing to its reactivity and potential applications in peptide synthesis. The methyl ester group allows for easier incorporation into larger molecules and can influence the compound's biological activity. Z-L-aspartic acid 1-methyl ester is often utilized in the synthesis of peptides and other bioactive compounds, making it valuable in pharmaceutical research and development. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and purity of the substance. As with many amino acid derivatives, it is important to handle this compound with care, following appropriate safety protocols.
Formula:C13H15NO6
InChI:InChI=1/C13H15NO6/c1-19-12(17)10(7-11(15)16)14-13(18)20-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,18)(H,15,16)/t10-/m0/s1
- Synonyms:
- Z-L-Aspartic acid Methylester
- Cbz-L-Aspartic Acid alpha-Methyl Ester
- Z-Asp-OMe
- (3S)-3-{[(benzyloxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (non-preferred name)
- Cbz-Asp-OMe
![L-Aspartic acid, N-[(phenylmethoxy)carbonyl]-, 1-methyl ester](https://static.cymitquimica.com/products/IN/thumb/DA0039M0.jpg)
