CAS 4669-02-7
:Iso-C16:0
Description:
Iso-C16:0, also known as isopalmitic acid, is a branched-chain fatty acid characterized by its structure, which includes a 16-carbon chain with a methyl branch at the second carbon. This compound is a saturated fatty acid, meaning it contains no double bonds between carbon atoms, resulting in a straight-chain configuration that contributes to its solid state at room temperature. Iso-C16:0 is typically found in various natural sources, including certain plant oils and animal fats. Its unique branched structure influences its physical properties, such as melting point and solubility, making it less crystalline compared to its straight-chain counterparts. Iso-C16:0 is utilized in various applications, including cosmetics, personal care products, and as a potential ingredient in food formulations. Additionally, it may play a role in biochemical processes and has garnered interest in research related to metabolic pathways. Overall, Iso-C16:0 is a versatile compound with distinct characteristics that differentiate it from other fatty acids.
Formula:C16H32O2
InChI:InChI=1S/C16H32O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18)
InChI key:InChIKey=ZONJATNKKGGVSU-UHFFFAOYSA-N
SMILES:C(CC(C)C)CCCCCCCCCCC(O)=O
Synonyms:- Iso-C16:0
- Isohexadecanoic acid
- Isopalmitic acid
- Pentadecanoic acid, 14-methyl-
- 14-Methylpentadecanoic acid
- 14-Methylpentadecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
14-Methylpentadecanoic acid
CAS:Formula:C16H32O2Purity:97.53%Color and Shape:Brownish. PowderMolecular weight:256.0Isopalmitic acid
CAS:Isopalmitic acid is a useful organic compound for research related to life sciences. The catalog number is T124825 and the CAS number is 4669-02-7.Formula:C16H32O2Color and Shape:SolidMolecular weight:256.4314-Methylpentadecanoic acid
CAS:Formula:C16H32O2Purity:>98%Color and Shape:SolidMolecular weight:256.4214-Methylpentadecanoic Acid
CAS:Controlled ProductApplications 14-Methylpentadecanoic Acid is a fatty acid found in the soft tissues of the Far-East bivalve mollusk Spisula sachalinensis. It is also a lipid biomarkers for microbial communities in hydrothermal chimney structures.
References Tabakaeva, O. V. and Tabakaev, A. V.: Chem. Nat. Compd. 53, 16 (2017); Lei, J., et al.: Geomicrobiol. J (2017)Formula:C16H32O2Color and Shape:White To Off-WhiteMolecular weight:256.424





