CAS 4669-59-4
:N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine
Description:
N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine, with the CAS number 4669-59-4, is an organosilicon compound characterized by its silane structure, which includes a silicon atom bonded to nitrogen atoms and ethyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low viscosity. It features a silanediamine backbone, which contributes to its reactivity and potential applications in various chemical processes, including as a ligand in coordination chemistry. The presence of multiple ethyl groups enhances its solubility in organic solvents, making it useful in formulations requiring compatibility with organic matrices. Additionally, the compound exhibits basic properties due to the amine functionalities, allowing it to participate in protonation and coordination reactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine is a versatile compound with applications in materials science and organic synthesis.
Formula:C10H26N2Si
InChI:InChI=1S/C10H26N2Si/c1-7-11(8-2)13(5,6)12(9-3)10-4/h7-10H2,1-6H3
InChI key:InChIKey=XIFOKLGEKUNZTI-UHFFFAOYSA-N
SMILES:[Si](N(CC)CC)(N(CC)CC)(C)C
Synonyms:- Dimethyldi(N,N-diethylamino)silane
- N,N,N',N'-tetraethyl-1,1-dimethylsilanediamine
- Nsc 379582
- Silanediamine, N,N,N',N'-tetraethyl-1,1-dimethyl-
- Bis(diethylamino)dimethylsilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bis(diethylamino)dimethylsilane
CAS:Formula:C10H26N2SiPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:202.42N,N,N',N'-Tetraethyl-1,1-Dimethylsilanediamine
CAS:N,N,N',N'-Tetraethyl-1,1-DimethylsilanediaminePurity:98%Molecular weight:202.41g/molBis(diethylamino)dimethylsilane
CAS:S01550 - Bis(diethylamino)dimethylsilane
Formula:C10H26N2SiPurity:95%Color and Shape:ClearMolecular weight:202.417Bis(diethylamino)dimethylsilane
CAS:Bis(diethylamino)dimethylsilane (BDEAS) is a solution that is used to react with organometallic compounds. It has been shown to be an effective catalyst for reactions involving molecular ions, such as the addition of silanes to unsaturated bonds. BDEAS has also been utilized in the synthesis of homologous compounds and in magnetic resonance spectroscopy studies of silicon-containing molecules. The optimal reaction temperature for this compound is between 100 and 150 degrees Celsius, although it can react at temperatures up to 200 degrees Celsius. The nature of this compound is biomolecular, which makes it ideal for use in biological applications.Formula:C10H26N2SiPurity:Min. 95%Molecular weight:202.42 g/molBis(Diethylamino)dimethylsilane
CAS:Formula:C10H26N2SiPurity:%Color and Shape:LiquidMolecular weight:202.4123




