CAS 4669-59-4: N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine
Description:N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine, with the CAS number 4669-59-4, is an organosilicon compound characterized by its silane structure, which includes a silicon atom bonded to nitrogen atoms and ethyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low viscosity. It features a silanediamine backbone, which contributes to its reactivity and potential applications in various chemical processes, including as a ligand in coordination chemistry. The presence of multiple ethyl groups enhances its solubility in organic solvents, making it useful in formulations requiring compatibility with organic matrices. Additionally, the compound exhibits basic properties due to the amine functionalities, allowing it to participate in protonation and coordination reactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, N,N,N′,N′-Tetraethyl-1,1-dimethylsilanediamine is a versatile compound with applications in materials science and organic synthesis.
Formula:C10H26N2Si
InChI:InChI=1S/C10H26N2Si/c1-7-11(8-2)13(5,6)12(9-3)10-4/h7-10H2,1-6H3
InChI key:InChIKey=XIFOKLGEKUNZTI-UHFFFAOYSA-N
SMILES:N(CC)(CC)[Si](N(CC)CC)(C)C
- Synonyms:
- Dimethyldi(N,N-diethylamino)silane
- N,N,N',N'-tetraethyl-1,1-dimethylsilanediamine
- Nsc 379582
- Silanediamine, N,N,N',N'-tetraethyl-1,1-dimethyl-
- Bis(diethylamino)dimethylsilane
Bis(diethylamino)dimethylsilane
Ref: 3B-B5496
| 5ml | 44.00 € | ||
| 25ml | 111.00 € |
Bis(diethylamino)dimethylsilane
Ref: 10-S01550
| 1g | 29.00 € | ||
| 5g | 62.00 € | ||
| 25g | 170.00 € |
Ref: IN-DA00D8ZZ
| 1g | 27.00 € | ||
| 5g | 66.00 € | ||
| 25g | 143.00 € |
Bis(diethylamino)dimethylsilane
Ref: 3D-EAA66959
| 10g | 331.00 € | ||
| 25g | 485.00 € | ||
| 50g | 611.00 € | ||
| 100g | 1,008.00 € |
BIS(DIETHYLAMINO)DIMETHYLSILANE
Ref: 3H-SIB1068.0
| 2kg | Discontinued | Request information |
