CAS 46698-24-2
:(3-bromophenyl)(4-fluorophenyl)methanone
Description:
(3-bromophenyl)(4-fluorophenyl)methanone, with the CAS number 46698-24-2, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a bromine atom at the meta position of one phenyl ring and a fluorine atom at the para position of the other, contributing to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the polar carbonyl group. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, as the halogen substituents can influence biological activity and chemical reactivity. Additionally, the presence of both bromine and fluorine can enhance lipophilicity, affecting the compound's interaction with biological membranes. As with many halogenated compounds, it is essential to handle this substance with care, considering potential environmental and health impacts associated with halogenated organic compounds.
Formula:C13H8BrFO
InChI:InChI=1/C13H8BrFO/c14-11-3-1-2-10(8-11)13(16)9-4-6-12(15)7-5-9/h1-8H
SMILES:c1cc(cc(c1)Br)C(=O)c1ccc(cc1)F
Synonyms:- Methanone, (3-Bromophenyl)(4-Fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

