
CAS 467-51-6
:(2S,5R,5aS,5bS,7aR,9S,10aS,10bS,12aR)-Octadecahydro-5a,7a-dimethyl-2,5-epoxycyclopenta[5,6]naphth[1,2-d]azepin-9-ol
Description:
The chemical substance with the name "(2S,5R,5aS,5bS,7aR,9S,10aS,10bS,12aR)-Octadecahydro-5a,7a-dimethyl-2,5-epoxycyclopenta[5,6]naphth[1,2-d]azepin-9-ol" and CAS number "467-51-6" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a bicyclic framework that includes a cyclopenta and naphthalene moiety, contributing to its unique three-dimensional shape. The presence of multiple chiral centers indicates that the compound can exist in various stereoisomeric forms, which can significantly influence its chemical behavior and biological activity. The epoxy group in its structure suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the hydroxyl group (–OH) indicates that the compound may exhibit hydrogen bonding capabilities, affecting its solubility and interaction with other molecules. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications and the complexity of its structure.
Formula:C19H31NO2
InChI:InChI=1S/C19H31NO2/c1-18-6-5-14-13(15(18)8-12(21)9-18)4-3-11-7-17-20-10-16(22-17)19(11,14)2/h11-17,20-21H,3-10H2,1-2H3/t11-,12+,13-,14+,15+,16+,17+,18-,19+/m1/s1
InChI key:InChIKey=HJCSQOSWSRPBOU-XTXNWKRWSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)C[C@@H](O)C4)[H])(CC[C@@]1(C[C@@]5(O[C@]2(CN5)[H])[H])[H])[H])[H]
Synonyms:- 3-Aza-A-homoandrostan-16-ol, 1,4-epoxy-, (1α,4α,5β,16β)-
- Samandarine
- Samandarin
- (2S,5R,5aS,5bS,7aR,9S,10aS,10bS,12aR)-Octadecahydro-5a,7a-dimethyl-2,5-epoxycyclopenta[5,6]naphth[1,2-d]azepin-9-ol
- 2,5-Epoxycyclopenta[5,6]naphth[1,2-d]azepin-9-ol, octadecahydro-5a,7a-dimethyl-, (2S,5R,5aS,5bS,7aR,9S,10aS,10bS,12aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Samandarine
CAS:<p>Samandarine, a toxic steroidal alkaloid from fire salamanders, causes convulsions, respiratory paralysis, and death.</p>Formula:C19H31NO2Color and Shape:SolidMolecular weight:305.45
